Products 886496-15-7
CAS 886496-15-7 is the registry number for 6-Cyclopropyl-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbohydrazide (CAS 886496-15-7) is a chemical compound with the molecular formula C12H15N5O and a molecular weight of 245.28 g/mol. IUPAC name: 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbohydrazide. InChIKey: LJDQATXURZASEW-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| InChIKey | LJDQATXURZASEW-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3CC3)C(=O)NN)C |
Computed by PubChem (NCBI)