CAS 246512-44-7 appears in our catalog under these names: Gefitinib Impurity 1, 2-Amino-4-methoxy-5-(3-(4-morpholinyl)propoxy)benzamide, Gefitinib impurity 2, Gefitinib impurity 2 98%, Gefitinib impurity 2, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 100mg, 5mg, 250mg, 1g, 5g, 5 mg, 10 mg.
2-amino-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzamide (CAS 246512-44-7) is a chemical compound with the molecular formula C15H23N3O4 and a molecular weight of 309.36 g/mol. IUPAC name: 2-amino-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzamide. InChIKey: HFUBNPPCNQAACT-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O4 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | 2-amino-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzamide |
| InChIKey | HFUBNPPCNQAACT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)C(=O)N)OCCCN2CCOCC2 |
Computed by PubChem (NCBI)