CAS 24690-19-5 is the registry number for 4-Aminophenyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-aminophenyl) methanesulfonate (CAS 24690-19-5) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: (4-aminophenyl) methanesulfonate. InChIKey: PKFRDPWUJPMCRJ-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | (4-aminophenyl) methanesulfonate |
| InChIKey | PKFRDPWUJPMCRJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)