CAS 2469037-64-5 appears in our catalog under these names: Isometronidazole-D4, Isometronidazole-d4 (hydroxyethyl-d4), 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,01g, 0,005g, 5 mg, 50 mg.
1,1,2,2-tetradeuterio-2-(2-methyl-4-nitroimidazol-1-yl)ethanol (CAS 2469037-64-5) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 175.18 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(2-methyl-4-nitroimidazol-1-yl)ethanol. InChIKey: RSXWJXPKLRYMHW-RRVWJQJTSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(2-methyl-4-nitroimidazol-1-yl)ethanol |
| InChIKey | RSXWJXPKLRYMHW-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N1C=C(N=C1C)[N+](=O)[O-] |
Computed by PubChem (NCBI)