CAS 2469278-96-2 appears in our catalog under these names: p–Cresol sulfate–d7 potassium, p-Cresol sulfate-d7 (potassium), 99.8%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg.
Potassium [2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] sulfate (CAS 2469278-96-2) is a chemical compound with the molecular formula C7H7KO4S and a molecular weight of 233.34 g/mol. IUPAC name: potassium [2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] sulfate. InChIKey: HTSFIPMTBJHYFQ-ANHTTWOXSA-M.
| Molecular formula | C7H7KO4S |
|---|---|
| Molecular weight | 233.34 g/mol |
| IUPAC name | potassium [2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] sulfate |
| InChIKey | HTSFIPMTBJHYFQ-ANHTTWOXSA-M |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])OS(=O)(=O)[O-])[2H].[K+] |
Computed by PubChem (NCBI)