CAS 24700-18-3 appears in our catalog under these names: (2,2-Dimethyl-3,4-dihydro-2h-chromen-4-yl)amine hydrochloride, 95%, 2,2-Dimethylchroman-4-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (CAS 24700-18-3) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride. InChIKey: OHBAWAXGKXWFAZ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| InChIKey | OHBAWAXGKXWFAZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=CC=CC=C2O1)N)C.Cl |
Computed by PubChem (NCBI)