CAS 2646585-67-1 appears in our catalog under these names: (S)-2,2-Dimethylchroman-4-amine hydrochloride 97%, (S)-2,2-Dimethylchroman-4-amine hydrochloride, 95%, 95%, (S)-2,2-Dimethylchroman-4-amine hydrochloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4S)-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (CAS 2646585-67-1) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (4S)-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride. InChIKey: OHBAWAXGKXWFAZ-FVGYRXGTSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (4S)-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| InChIKey | OHBAWAXGKXWFAZ-FVGYRXGTSA-N |
| SMILES | CC1(C[C@@H](C2=CC=CC=C2O1)N)C.Cl |
Computed by PubChem (NCBI)