Products 2470233-08-8
CAS 2470233-08-8 appears in our catalog under these names: Bisdemethoxycurcumin–d8, Bisdemethoxycurcumin-d8, 98.0%, Bisdemethoxycurcumin-d8, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 5 mg, 1 mg, 1mg.
(1E,6E)-1,7-bis(2,3,5,6-tetradeuterio-4-hydroxyphenyl)hepta-1,6-diene-3,5-dione (CAS 2470233-08-8) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 316.4 g/mol. IUPAC name: (1E,6E)-1,7-bis(2,3,5,6-tetradeuterio-4-hydroxyphenyl)hepta-1,6-diene-3,5-dione. InChIKey: PREBVFJICNPEKM-PHMSPZQVSA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (1E,6E)-1,7-bis(2,3,5,6-tetradeuterio-4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| InChIKey | PREBVFJICNPEKM-PHMSPZQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1/C=C/C(=O)CC(=O)/C=C/C2=C(C(=C(C(=C2[2H])[2H])O)[2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)