CAS 2470278-90-9 appears in our catalog under these names: N-Nitroso Rasagiline, N-Nitro Rasagiline, N-Nitrosorasagiline, N-NITROSO RASAGILINE SOLUTION, (R)-N-(2,3-Dihydro-1H-inden-1-yl)-N-(prop-2-yn-1-yl)nitrous amide. Offered by: Chemat Brand, TRC, Mikromol, Sigma-Aldrich, Chemat. Available pack sizes: on request, 250mg, 500mg, 50mg, 25mg, 1ML, 1g, 1x10mg.
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-prop-2-ynylnitrous amide (CAS 2470278-90-9) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: N-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-prop-2-ynylnitrous amide. InChIKey: RPWRDVPRBADQLQ-GFCCVEGCSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-prop-2-ynylnitrous amide |
| InChIKey | RPWRDVPRBADQLQ-GFCCVEGCSA-N |
| SMILES | C#CCN([C@@H]1CCC2=CC=CC=C12)N=O |
Computed by PubChem (NCBI)