Products 247134-05-0

CAS 247134-05-0 is the registry number for Ethyl 3-(benzylamino)-4,4,4-trifluorobutanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 3-(benzylamino)-4,4,4-trifluorobutanoate (CAS 247134-05-0) is a chemical compound with the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. IUPAC name: ethyl 3-(benzylamino)-4,4,4-trifluorobutanoate. InChIKey: KJXNJNVKUIYFNX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16F3NO2
Molecular weight275.27 g/mol
IUPAC nameethyl 3-(benzylamino)-4,4,4-trifluorobutanoate
InChIKeyKJXNJNVKUIYFNX-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C(F)(F)F)NCC1=CC=CC=C1

Computed by PubChem (NCBI)