CAS 2641630-84-2 is the registry number for (S)-3-(2,5-Dimethoxy-4-(trifluoromethyl)phenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]pyrrolidine (CAS 2641630-84-2) is a chemical compound with the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. IUPAC name: (3S)-3-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]pyrrolidine. InChIKey: NYLBGIMZRUITMZ-MRVPVSSYSA-N.
| Molecular formula | C13H16F3NO2 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | (3S)-3-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]pyrrolidine |
| InChIKey | NYLBGIMZRUITMZ-MRVPVSSYSA-N |
| SMILES | COC1=CC(=C(C=C1[C@@H]2CCNC2)OC)C(F)(F)F |
Computed by PubChem (NCBI)