Products 2764729-22-6
CAS 2764729-22-6 is the registry number for N,N-diethyl-2-methoxy-5-(trifluoromethyl)benzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
N,N-diethyl-2-methoxy-5-(trifluoromethyl)benzamide (CAS 2764729-22-6) is a chemical compound with the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. IUPAC name: N,N-diethyl-2-methoxy-5-(trifluoromethyl)benzamide. InChIKey: HHTUFFXAUZXQGC-UHFFFAOYSA-N.
| Molecular formula | C13H16F3NO2 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | N,N-diethyl-2-methoxy-5-(trifluoromethyl)benzamide |
| InChIKey | HHTUFFXAUZXQGC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=CC(=C1)C(F)(F)F)OC |
Computed by PubChem (NCBI)