Products 247186-56-7
CAS 247186-56-7 appears in our catalog under these names: tert–Butyl 3–formylbenzoate, tert-butyl 3-formylbenzoate, tert-Butyl 3-formylbenzoate 96%, tert-Butyl 3-formylbenzoate, 96%, 96%, tert-Butyl 3-formylbenzoate, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g, 5g, 25g, 500mg, 10g.
Tert-butyl 3-formylbenzoate (CAS 247186-56-7) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: tert-butyl 3-formylbenzoate. InChIKey: GGPVOXVKIVXELX-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | tert-butyl 3-formylbenzoate |
| InChIKey | GGPVOXVKIVXELX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C=O |
Computed by PubChem (NCBI)