Products 2474774-17-7
CAS 2474774-17-7 appears in our catalog under these names: Siponimod Impurity 25, Siponimod Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(4-acetyl-2-ethylphenyl)methyl]azetidine-3-carboxylic acid (CAS 2474774-17-7) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: 1-[(4-acetyl-2-ethylphenyl)methyl]azetidine-3-carboxylic acid. InChIKey: SRJWRNKGAMJCKO-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | 1-[(4-acetyl-2-ethylphenyl)methyl]azetidine-3-carboxylic acid |
| InChIKey | SRJWRNKGAMJCKO-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)C(=O)C)CN2CC(C2)C(=O)O |
Computed by PubChem (NCBI)