CAS 24760-30-3 is the registry number for 2-((4-(isopropyl)phenyl)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg, 5000mg, 2000mg.
2-[(4-propan-2-ylphenyl)methylidene]indene-1,3-dione (CAS 24760-30-3) is a chemical compound with the molecular formula C19H16O2 and a molecular weight of 276.3 g/mol. IUPAC name: 2-[(4-propan-2-ylphenyl)methylidene]indene-1,3-dione. InChIKey: CNPNLHKIFNOMCD-UHFFFAOYSA-N.
| Molecular formula | C19H16O2 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 2-[(4-propan-2-ylphenyl)methylidene]indene-1,3-dione |
| InChIKey | CNPNLHKIFNOMCD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C=C2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)