CAS 2477608-75-4 is the registry number for Rel-4-((2R,3R)-5-bromo-3-methyl-2,3-dihydrobenzofuran-2-yl)-2-methoxyphenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2R,3R)-5-bromo-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenol (CAS 2477608-75-4) is a chemical compound with the molecular formula C16H15BrO3 and a molecular weight of 335.19 g/mol. IUPAC name: 4-[(2R,3R)-5-bromo-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenol. InChIKey: QODYKBWGJVSUBH-JDNHERCYSA-N.
| Molecular formula | C16H15BrO3 |
|---|---|
| Molecular weight | 335.19 g/mol |
| IUPAC name | 4-[(2R,3R)-5-bromo-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenol |
| InChIKey | QODYKBWGJVSUBH-JDNHERCYSA-N |
| SMILES | C[C@H]1[C@@H](OC2=C1C=C(C=C2)Br)C3=CC(=C(C=C3)O)OC |
Computed by PubChem (NCBI)