Products 868598-97-4
CAS 868598-97-4 appears in our catalog under these names: 2-(4-(Benzyloxy)-3-bromophenyl)-1,3-dioxolane, 95%, 2-(4-(Benzyloxy)-3-bromophenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-(3-bromo-4-phenylmethoxyphenyl)-1,3-dioxolane (CAS 868598-97-4) is a chemical compound with the molecular formula C16H15BrO3 and a molecular weight of 335.19 g/mol. IUPAC name: 2-(3-bromo-4-phenylmethoxyphenyl)-1,3-dioxolane. InChIKey: HOUVWMNIQUXXQH-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO3 |
|---|---|
| Molecular weight | 335.19 g/mol |
| IUPAC name | 2-(3-bromo-4-phenylmethoxyphenyl)-1,3-dioxolane |
| InChIKey | HOUVWMNIQUXXQH-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)OCC3=CC=CC=C3)Br |
Computed by PubChem (NCBI)