CAS 340216-57-1 is the registry number for 2-Bromo-5-methoxy-4-((4-methylbenzyl)oxy)benzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]benzaldehyde (CAS 340216-57-1) is a chemical compound with the molecular formula C16H15BrO3 and a molecular weight of 335.19 g/mol. IUPAC name: 2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]benzaldehyde. InChIKey: OEFMEZNPKYBIKX-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO3 |
|---|---|
| Molecular weight | 335.19 g/mol |
| IUPAC name | 2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]benzaldehyde |
| InChIKey | OEFMEZNPKYBIKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COC2=C(C=C(C(=C2)Br)C=O)OC |
Computed by PubChem (NCBI)