CAS 2477608-77-6 is the registry number for Rel-(2R,3R)-5-bromo-2-(4-methoxyphenyl)-3-methyl-2,3-dihydrobenzofuran, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-5-bromo-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran (CAS 2477608-77-6) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: (2R,3R)-5-bromo-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran. InChIKey: BWRIKBHEJIMUHB-QLJPJBMISA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | (2R,3R)-5-bromo-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran |
| InChIKey | BWRIKBHEJIMUHB-QLJPJBMISA-N |
| SMILES | C[C@H]1[C@@H](OC2=C1C=C(C=C2)Br)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)