CAS 24779-68-8 appears in our catalog under these names: 2-Adamantan-malonic acid, 98+%, 1-Adamantylmalonic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2g, 1g.
2-(1-adamantyl)propanedioic acid (CAS 24779-68-8) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 2-(1-adamantyl)propanedioic acid. InChIKey: PJDWEIFODWCDAV-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-(1-adamantyl)propanedioic acid |
| InChIKey | PJDWEIFODWCDAV-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)