CAS 248249-55-0 appears in our catalog under these names: 2-(2H-1,3-Benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(1,3-Dioxaindan-5-yl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid (CAS 248249-55-0) is a chemical compound with the molecular formula C11H7NO4S and a molecular weight of 249.24 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: GYFWKVTWSJTRBO-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4S |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | GYFWKVTWSJTRBO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)