Products 952958-63-3
CAS 952958-63-3 is the registry number for 4-(1,3-dioxaindan-5-yl)-1,3-thiazole-2-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(1,3-benzodioxol-5-yl)-1,3-thiazole-2-carboxylic acid (CAS 952958-63-3) is a chemical compound with the molecular formula C11H7NO4S and a molecular weight of 249.24 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-1,3-thiazole-2-carboxylic acid. InChIKey: QFPVVKPZLTVMPO-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4S |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | QFPVVKPZLTVMPO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CSC(=N3)C(=O)O |
Computed by PubChem (NCBI)