Products 80387-79-7

CAS 80387-79-7 is the registry number for 5-(4-Nitrophenyl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(4-nitrophenyl)thiophene-2-carboxylic acid (CAS 80387-79-7) is a chemical compound with the molecular formula C11H7NO4S and a molecular weight of 249.24 g/mol. IUPAC name: 5-(4-nitrophenyl)thiophene-2-carboxylic acid. InChIKey: KQLUSGVTGAPFDW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7NO4S
Molecular weight249.24 g/mol
IUPAC name5-(4-nitrophenyl)thiophene-2-carboxylic acid
InChIKeyKQLUSGVTGAPFDW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC=C(S2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)