CAS 248270-23-7 appears in our catalog under these names: 2-(4-Bromo-2-fluorophenyl)-1,3-dioxolane, 95%, 2-(4-Bromo-2-fluorophenyl)-1,3-dioxolane, 95-<97%, 2-(4-Bromo-2-fluorophenyl)-1,3-dioxolane, ≥97-<99%, 2–(4–Bromo–2–fluorophenyl)–1，3–dioxolane, 2-(4-Bromo-2-Fluorophenyl)-1,3-Dioxolane, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 50g, 100g, 200g, 300g, 400g.
2-(4-bromo-2-fluorophenyl)-1,3-dioxolane (CAS 248270-23-7) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-1,3-dioxolane. InChIKey: QBJYRHCYSHXBAY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-1,3-dioxolane |
| InChIKey | QBJYRHCYSHXBAY-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)