Products 2482764-71-4
CAS 2482764-71-4 is the registry number for Antileishmanial agent-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-(2-methylprop-1-enyl)-1,4-dioxonaphthalen-2-yl] 3-(1-phenyltriazol-4-yl)propanoate (CAS 2482764-71-4) is a chemical compound with the molecular formula C25H21N3O4 and a molecular weight of 427.5 g/mol. IUPAC name: [3-(2-methylprop-1-enyl)-1,4-dioxonaphthalen-2-yl] 3-(1-phenyltriazol-4-yl)propanoate. InChIKey: OQTMIDIYWCZMCR-UHFFFAOYSA-N.
| Molecular formula | C25H21N3O4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | [3-(2-methylprop-1-enyl)-1,4-dioxonaphthalen-2-yl] 3-(1-phenyltriazol-4-yl)propanoate |
| InChIKey | OQTMIDIYWCZMCR-UHFFFAOYSA-N |
| SMILES | CC(=CC1=C(C(=O)C2=CC=CC=C2C1=O)OC(=O)CCC3=CN(N=N3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)
Synonyms:
Antileishmanial agent-12, orb1687714