CAS 2483829-30-5 appears in our catalog under these names: L–Asparagine–13C4,15N2,d3 monohydrate, L-Asparagine-13C4,15N2,d3 (monohydrate), 99.90%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 100 mg, 50 mg, 1 mg, 5 mg, 10 mg, 25 mg.
(2S)-2,4-bis(15N)(azanyl)-2,3,3-trideuterio-4-oxo(1,2,3,4-13C4)butanoic acid;hydrate (CAS 2483829-30-5) is a chemical compound with the molecular formula C4H10N2O4 and a molecular weight of 159.11 g/mol. IUPAC name: (2S)-2,4-bis(15N)(azanyl)-2,3,3-trideuterio-4-oxo(1,2,3,4-13C4)butanoic acid;hydrate. InChIKey: RBMGJIZCEWRQES-DIWHROOWSA-N.
| Molecular formula | C4H10N2O4 |
|---|---|
| Molecular weight | 159.11 g/mol |
| IUPAC name | (2S)-2,4-bis(15N)(azanyl)-2,3,3-trideuterio-4-oxo(1,2,3,4-13C4)butanoic acid;hydrate |
| InChIKey | RBMGJIZCEWRQES-DIWHROOWSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])[13C](=O)[15NH2])[15NH2].O |
Computed by PubChem (NCBI)