Products 2483829-34-9
CAS 2483829-34-9 is the registry number for L-Isoleucine-13C6,15N,d10, 99.9%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg, 25 mg, 50 mg, 100 mg.
(2S,3S)-2-(15N)azanyl-2,3,4,4,5,5,5-heptadeuterio-3-(trideuterio(113C)methyl)(1,2,3,4,5-13C5)pentanoic acid (CAS 2483829-34-9) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 148.184 g/mol. IUPAC name: (2S,3S)-2-(15N)azanyl-2,3,4,4,5,5,5-heptadeuterio-3-(trideuterio(113C)methyl)(1,2,3,4,5-13C5)pentanoic acid. InChIKey: AGPKZVBTJJNPAG-JIFBZMLASA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 148.184 g/mol |
| IUPAC name | (2S,3S)-2-(15N)azanyl-2,3,4,4,5,5,5-heptadeuterio-3-(trideuterio(113C)methyl)(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | AGPKZVBTJJNPAG-JIFBZMLASA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C@@]([2H])([13C]([2H])([2H])[2H])[13C]([2H])([2H])[13C]([2H])([2H])[2H])[15NH2] |
Computed by PubChem (NCBI)