CAS 2483831-28-1 appears in our catalog under these names: 4,4'–Sulfonyldiphenol–d8, Bisphenol S-2,2',3,3',5,5',6,6'-d8, 98 atom % D, min 98% Chemical Purity, 4,4'-Sulfonyldiphenol-d8, 4,4'-Sulfonyldiphenol-d8, 99.21%, D8-Bisphenol S, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: GLPBio, CDN, TargetMol, MedChemExpress, HPC Standards. Available pack sizes: 1mg, 0,01g, 0,005g, 5mg, 1 mg, 5 mg, 1x1ml.
2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)sulfonylphenol (CAS 2483831-28-1) is a chemical compound with the molecular formula C12H10O4S and a molecular weight of 258.32 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)sulfonylphenol. InChIKey: VPWNQTHUCYMVMZ-PGRXLJNUSA-N.
| Molecular formula | C12H10O4S |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)sulfonylphenol |
| InChIKey | VPWNQTHUCYMVMZ-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1O)[2H])[2H])S(=O)(=O)C2=C(C(=C(C(=C2[2H])[2H])O)[2H])[2H])[2H] |
Computed by PubChem (NCBI)