CAS 2484889-30-5 appears in our catalog under these names: 1-Methyl-4-(4-methylbenzyl)-1h-pyrazole, 95%, 1-Methyl-4-(p-tolylmethyl)pyrazole, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
1-methyl-4-[(4-methylphenyl)methyl]pyrazole (CAS 2484889-30-5) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 1-methyl-4-[(4-methylphenyl)methyl]pyrazole. InChIKey: JYAFIIZBHBDPSU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 1-methyl-4-[(4-methylphenyl)methyl]pyrazole |
| InChIKey | JYAFIIZBHBDPSU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=CN(N=C2)C |
Computed by PubChem (NCBI)