CAS 2489451-28-5 is the registry number for 3-Cyclopropylpyrazolo[1,5-a]pyrimidine-5,7-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one (CAS 2489451-28-5) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 3-cyclopropyl-7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one. InChIKey: ZWJRUKBANPEBBL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 3-cyclopropyl-7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| InChIKey | ZWJRUKBANPEBBL-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C3NC(=O)C=C(N3N=C2)O |
Computed by PubChem (NCBI)