Products 2494280-04-3
CAS 2494280-04-3 is the registry number for ANO1-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(7,7-dimethylfuro[2,3-f]chromen-2-yl)-3-(1H-pyrrol-2-yl)prop-2-en-1-one (CAS 2494280-04-3) is a chemical compound with the molecular formula C20H17NO3 and a molecular weight of 319.4 g/mol. IUPAC name: (E)-1-(7,7-dimethylfuro[2,3-f]chromen-2-yl)-3-(1H-pyrrol-2-yl)prop-2-en-1-one. InChIKey: JCDPWACOSJEUQO-VOTSOKGWSA-N.
| Molecular formula | C20H17NO3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (E)-1-(7,7-dimethylfuro[2,3-f]chromen-2-yl)-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
| InChIKey | JCDPWACOSJEUQO-VOTSOKGWSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC3=C2OC(=C3)C(=O)/C=C/C4=CC=CN4)C |
Computed by PubChem (NCBI)