Products 24979-71-3
CAS 24979-71-3 appears in our catalog under these names: POLY(4-VINYLPHENOL-CO-METHYL METHACRYLA&, 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 4-ethenylphenol. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 50G, 5g, 25g.
4-ethenylphenol;methyl 2-methylprop-2-enoate (CAS 24979-71-3) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 4-ethenylphenol;methyl 2-methylprop-2-enoate. InChIKey: CRHKEARBQJYMBY-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 4-ethenylphenol;methyl 2-methylprop-2-enoate |
| InChIKey | CRHKEARBQJYMBY-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC.C=CC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)