Products 250293-31-3
CAS 250293-31-3 is the registry number for Excavatin M. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
7-[[3-[(4-hydroxy-4-methyl-5-oxooxolan-2-yl)methyl]-3-methyloxiran-2-yl]methoxy]chromen-2-one (CAS 250293-31-3) is a chemical compound with the molecular formula C19H20O7 and a molecular weight of 360.4 g/mol. IUPAC name: 7-[[3-[(4-hydroxy-4-methyl-5-oxooxolan-2-yl)methyl]-3-methyloxiran-2-yl]methoxy]chromen-2-one. InChIKey: UMYAEKVHXDURJS-UHFFFAOYSA-N.
| Molecular formula | C19H20O7 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 7-[[3-[(4-hydroxy-4-methyl-5-oxooxolan-2-yl)methyl]-3-methyloxiran-2-yl]methoxy]chromen-2-one |
| InChIKey | UMYAEKVHXDURJS-UHFFFAOYSA-N |
| SMILES | CC1(CC(OC1=O)CC2(C(O2)COC3=CC4=C(C=C3)C=CC(=O)O4)C)O |
Computed by PubChem (NCBI)