Products 71593-10-7
CAS 71593-10-7 is the registry number for Abruquinone A. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(3S)-6,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione (CAS 71593-10-7) is a chemical compound with the molecular formula C19H20O7 and a molecular weight of 360.4 g/mol. IUPAC name: 5-[(3S)-6,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione. InChIKey: ILLAZKQERSVUDX-LLVKDONJSA-N.
| Molecular formula | C19H20O7 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-[(3S)-6,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
| InChIKey | ILLAZKQERSVUDX-LLVKDONJSA-N |
| SMILES | COC1=C(C=C2C(=C1)C[C@H](CO2)C3=CC(=O)C(=C(C3=O)OC)OC)OC |
Computed by PubChem (NCBI)