CAS 588706-66-5 is the registry number for Ophiopogonanone E. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 5 mg, 1 mg.
5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-8-methoxy-6-methyl-2,3-dihydrochromen-4-one (CAS 588706-66-5) is a chemical compound with the molecular formula C19H20O7 and a molecular weight of 360.4 g/mol. IUPAC name: 5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-8-methoxy-6-methyl-2,3-dihydrochromen-4-one. InChIKey: FMFZMWWKEGLLRS-UHFFFAOYSA-N.
| Molecular formula | C19H20O7 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-8-methoxy-6-methyl-2,3-dihydrochromen-4-one |
| InChIKey | FMFZMWWKEGLLRS-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C(=C1O)OC)OCC(C2=O)CC3=C(C=C(C=C3)OC)O)O |
Computed by PubChem (NCBI)