Products 2504178-70-3
CAS 2504178-70-3 is the registry number for N-[1,1′-Biphenyl]-4-yl-6-(2-naphthalenyl)[1,1′-biphenyl]-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-naphthalen-2-yl-3-phenyl-N-(4-phenylphenyl)aniline (CAS 2504178-70-3) is a chemical compound with the molecular formula C34H25N and a molecular weight of 447.6 g/mol. IUPAC name: 4-naphthalen-2-yl-3-phenyl-N-(4-phenylphenyl)aniline. InChIKey: YXCMFPKLZVTERN-UHFFFAOYSA-N.
| Molecular formula | C34H25N |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | 4-naphthalen-2-yl-3-phenyl-N-(4-phenylphenyl)aniline |
| InChIKey | YXCMFPKLZVTERN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC(=C(C=C3)C4=CC5=CC=CC=C5C=C4)C6=CC=CC=C6 |
Computed by PubChem (NCBI)