Products 2634130-35-9
CAS 2634130-35-9 is the registry number for N-[3-(1-naphthalenyl)phenyl]-[1,1′:4′,1′′-Terphenyl]-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(3-naphthalen-1-ylphenyl)-3-(4-phenylphenyl)aniline (CAS 2634130-35-9) is a chemical compound with the molecular formula C34H25N and a molecular weight of 447.6 g/mol. IUPAC name: N-(3-naphthalen-1-ylphenyl)-3-(4-phenylphenyl)aniline. InChIKey: YCOBENRIUYJVHV-UHFFFAOYSA-N.
| Molecular formula | C34H25N |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | N-(3-naphthalen-1-ylphenyl)-3-(4-phenylphenyl)aniline |
| InChIKey | YCOBENRIUYJVHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC(=CC=C3)NC4=CC=CC(=C4)C5=CC=CC6=CC=CC=C65 |
Computed by PubChem (NCBI)