CAS 2784692-88-0 is the registry number for N-[4-(4-Phenyl-1-naphthalenyl)phenyl][1,1′-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-phenyl-N-[4-(4-phenylnaphthalen-1-yl)phenyl]aniline (CAS 2784692-88-0) is a chemical compound with the molecular formula C34H25N and a molecular weight of 447.6 g/mol. IUPAC name: 4-phenyl-N-[4-(4-phenylnaphthalen-1-yl)phenyl]aniline. InChIKey: HOIGPFYLZDRDTK-UHFFFAOYSA-N.
| Molecular formula | C34H25N |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | 4-phenyl-N-[4-(4-phenylnaphthalen-1-yl)phenyl]aniline |
| InChIKey | HOIGPFYLZDRDTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC=C(C5=CC=CC=C54)C6=CC=CC=C6 |
Computed by PubChem (NCBI)