CAS 897921-61-8 is the registry number for N-[1,1′-Biphenyl]-4-yl-4′-(1-naphthalenyl)[1,1′-biphenyl]-4-amine, 99%, 99%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-phenylaniline (CAS 897921-61-8) is a chemical compound with the molecular formula C34H25N and a molecular weight of 447.6 g/mol. IUPAC name: N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-phenylaniline. InChIKey: LPUDPWGKNCPKTP-UHFFFAOYSA-N.
| Molecular formula | C34H25N |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | N-[4-(4-naphthalen-1-ylphenyl)phenyl]-4-phenylaniline |
| InChIKey | LPUDPWGKNCPKTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC=C(C=C4)C5=CC=CC6=CC=CC=C65 |
Computed by PubChem (NCBI)