Products 2504202-31-5
CAS 2504202-31-5 is the registry number for 2-(3-Bromo-5-fluorophenyl)-n-ethylacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(3-bromo-5-fluorophenyl)-N-ethylacetamide (CAS 2504202-31-5) is a chemical compound with the molecular formula C10H11BrFNO and a molecular weight of 260.10 g/mol. IUPAC name: 2-(3-bromo-5-fluorophenyl)-N-ethylacetamide. InChIKey: JYIWGPODRDYMLM-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 2-(3-bromo-5-fluorophenyl)-N-ethylacetamide |
| InChIKey | JYIWGPODRDYMLM-UHFFFAOYSA-N |
| SMILES | CCNC(=O)CC1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)