Products 2504202-60-0

CAS 2504202-60-0 is the registry number for (3-Ethynyl-5-fluoro-phenyl)-methyl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Tert-butyl N-(3-ethynyl-5-fluorophenyl)-N-methylcarbamate (CAS 2504202-60-0) is a chemical compound with the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. IUPAC name: tert-butyl N-(3-ethynyl-5-fluorophenyl)-N-methylcarbamate. InChIKey: KFPLXZWDTXICGO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16FNO2
Molecular weight249.28 g/mol
IUPAC nametert-butyl N-(3-ethynyl-5-fluorophenyl)-N-methylcarbamate
InChIKeyKFPLXZWDTXICGO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)C1=CC(=CC(=C1)C#C)F

Computed by PubChem (NCBI)