Products 2890778-84-2
CAS 2890778-84-2 is the registry number for tert-Butyl (4-ethynyl-3-fluorobenzyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(4-ethynyl-3-fluorophenyl)methyl]carbamate (CAS 2890778-84-2) is a chemical compound with the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. IUPAC name: tert-butyl N-[(4-ethynyl-3-fluorophenyl)methyl]carbamate. InChIKey: DMWJRFCECIRZEM-UHFFFAOYSA-N.
| Molecular formula | C14H16FNO2 |
|---|---|
| Molecular weight | 249.28 g/mol |
| IUPAC name | tert-butyl N-[(4-ethynyl-3-fluorophenyl)methyl]carbamate |
| InChIKey | DMWJRFCECIRZEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)C#C)F |
Computed by PubChem (NCBI)