Products 2703812-55-7
CAS 2703812-55-7 appears in our catalog under these names: 5–fluoro PB–22 3–carboxyindole metabolite–d5 (CRM), 1-(5-Fluoropentyl)-1H-indole-3-carboxylic acid-d5. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, Get quote.
2,4,5,6,7-pentadeuterio-1-(5-fluoropentyl)indole-3-carboxylic acid (CAS 2703812-55-7) is a chemical compound with the molecular formula C14H16FNO2 and a molecular weight of 254.31 g/mol. IUPAC name: 2,4,5,6,7-pentadeuterio-1-(5-fluoropentyl)indole-3-carboxylic acid. InChIKey: DYLIZXRQZRUDLA-ZYNMDDLASA-N.
| Molecular formula | C14H16FNO2 |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 2,4,5,6,7-pentadeuterio-1-(5-fluoropentyl)indole-3-carboxylic acid |
| InChIKey | DYLIZXRQZRUDLA-ZYNMDDLASA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCCF)[2H])C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)