CAS 2504202-63-3 is the registry number for 3-(Aminomethyl)[1,2,4]triazolo[4,3-b]pyridazin-6-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-(aminomethyl)-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one;hydrochloride (CAS 2504202-63-3) is a chemical compound with the molecular formula C6H8ClN5O and a molecular weight of 201.61 g/mol. IUPAC name: 3-(aminomethyl)-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one;hydrochloride. InChIKey: OIAUQKOVZNSFMR-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN5O |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 3-(aminomethyl)-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one;hydrochloride |
| InChIKey | OIAUQKOVZNSFMR-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2NC1=O)CN.Cl |
Computed by PubChem (NCBI)