CAS 27446-01-1 is the registry number for 2-(Methylamino)-6,7-dihydro-3H-purin-6-one Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
2-(methylamino)-1,7-dihydropurin-6-one;hydrochloride (CAS 27446-01-1) is a chemical compound with the molecular formula C6H8ClN5O and a molecular weight of 201.61 g/mol. IUPAC name: 2-(methylamino)-1,7-dihydropurin-6-one;hydrochloride. InChIKey: IOVUTPCHARXWAC-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN5O |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-(methylamino)-1,7-dihydropurin-6-one;hydrochloride |
| InChIKey | IOVUTPCHARXWAC-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(C(=O)N1)NC=N2.Cl |
Computed by PubChem (NCBI)