CAS 786693-71-8 appears in our catalog under these names: 2-Amino-7-methyl-1h-purin-6(7h)-one hydrochloride, 95%, 2–Amino–7–methyl–1H–purin–6(7H)–one hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-amino-7-methyl-1H-purin-6-one;hydrochloride (CAS 786693-71-8) is a chemical compound with the molecular formula C6H8ClN5O and a molecular weight of 201.61 g/mol. IUPAC name: 2-amino-7-methyl-1H-purin-6-one;hydrochloride. InChIKey: QSUPOMMMOISQBB-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN5O |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-amino-7-methyl-1H-purin-6-one;hydrochloride |
| InChIKey | QSUPOMMMOISQBB-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=O)NC(=N2)N.Cl |
Computed by PubChem (NCBI)