Products 2504204-10-6
CAS 2504204-10-6 is the registry number for tert-Butyl 4-(4-formylphenoxy)-1h-pyrazole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 4-(4-formylphenoxy)pyrazole-1-carboxylate (CAS 2504204-10-6) is a chemical compound with the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. IUPAC name: tert-butyl 4-(4-formylphenoxy)pyrazole-1-carboxylate. InChIKey: WDCAIULQGGVHBO-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | tert-butyl 4-(4-formylphenoxy)pyrazole-1-carboxylate |
| InChIKey | WDCAIULQGGVHBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=N1)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)