CAS 5729-19-1 is the registry number for (3,4-Dimethoxybenzyl)(2-nitrophenyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
N-[(3,4-dimethoxyphenyl)methyl]-2-nitroaniline (CAS 5729-19-1) is a chemical compound with the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)methyl]-2-nitroaniline. InChIKey: GNUZCONTOLKVBR-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)methyl]-2-nitroaniline |
| InChIKey | GNUZCONTOLKVBR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CNC2=CC=CC=C2[N+](=O)[O-])OC |
Computed by PubChem (NCBI)