CAS 355137-87-0 appears in our catalog under these names: Ac-ala-amc, 95%, Ac-Ala-AMC, Ac-Ala-MCA, 95+%, Ac–Ala–AMC, Acetyl-L-alanine 7-amido-4-methylcoumarin. Offered by: Combi-blocks, Creative Peptides, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 50mg, 250mg, 25mg, 100mg, 500mg.
(2S)-2-acetamido-N-(4-methyl-2-oxochromen-7-yl)propanamide (CAS 355137-87-0) is a chemical compound with the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. IUPAC name: (2S)-2-acetamido-N-(4-methyl-2-oxochromen-7-yl)propanamide. InChIKey: JOAJYKBVKPNJQC-VIFPVBQESA-N.
| Molecular formula | C15H16N2O4 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | (2S)-2-acetamido-N-(4-methyl-2-oxochromen-7-yl)propanamide |
| InChIKey | JOAJYKBVKPNJQC-VIFPVBQESA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)NC(=O)C |
Computed by PubChem (NCBI)