Products 2504241-20-5
CAS 2504241-20-5 is the registry number for 6-Bromo-1-[(4-methoxyphenyl)methyl]benz[cd]indol-2(1H)-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
6-bromo-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one (CAS 2504241-20-5) is a chemical compound with the molecular formula C19H14BrNO2 and a molecular weight of 368.2 g/mol. IUPAC name: 6-bromo-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one. InChIKey: QSXGBQYKZDCGQH-UHFFFAOYSA-N.
| Molecular formula | C19H14BrNO2 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | 6-bromo-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one |
| InChIKey | QSXGBQYKZDCGQH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=C4C(=C(C=C3)Br)C=CC=C4C2=O |
Computed by PubChem (NCBI)